C18H26FN2O+ — CID 11931269
2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide (PubChem CID 11931269) has the molecular formula C18H26FN2O+ and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide.
| Compound Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 11931269 |
| Molecular Formula | C18H26FN2O+ |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)C[NH+]2CCC[C@H]3CCCC[C@@H]32)cc1F |
| InChI | InChI=1S/C18H25FN2O/c1-13-8-9-15(11-16(13)19)20-18(22)12-21-10-4-6-14-5-2-3-7-17(14)21/h8-9,11,14,17H,2-7,10,12H2,1H3,(H,20,22)/p+1/t14-,17+/m1/s1 |
| InChIKey | NXJQTPKPXHVTDM-PBHICJAKSA-O |
| XLogP | 2.31 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |