C19H27N2O3+ — CID 11931113
methyl 4-[[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]acetyl]amino]benzoate (PubChem CID 11931113) has the molecular formula C19H27N2O3+ and a molecular weight of 331.44 g/mol. Its IUPAC name is methyl 4-[[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 11931113 |
| Molecular Formula | C19H27N2O3+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | methyl 4-[[2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C[NH+]2CCC[C@@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-24-19(23)15-8-10-16(11-9-15)20-18(22)13-21-12-4-6-14-5-2-3-7-17(14)21/h8-11,14,17H,2-7,12-13H2,1H3,(H,20,22)/p+1/t14-,17-/m0/s1 |
| InChIKey | CHAGBZVCLFWTDW-YOEHRIQHSA-O |
| XLogP | 1.65 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |