C15H17NO5 — CID 8019672
methyl 4-[[2-(cyclobutanecarbonyloxy)acetyl]amino]benzoate (PubChem CID 8019672) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is methyl 4-[[2-(cyclobutanecarbonyloxy)acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(cyclobutanecarbonyloxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 8019672 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | methyl 4-[[2-(cyclobutanecarbonyloxy)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COC(=O)C2CCC2)cc1 |
| InChI | InChI=1S/C15H17NO5/c1-20-14(18)11-5-7-12(8-6-11)16-13(17)9-21-15(19)10-3-2-4-10/h5-8,10H,2-4,9H2,1H3,(H,16,17) |
| InChIKey | PZVDEMLNPNSYGI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |