C17H24N2O3 — CID 3621562
[2-[4-(dimethylamino)anilino]-2-oxoethyl] cyclohexanecarboxylate (PubChem CID 3621562) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] cyclohexanecarboxylate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 3621562 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] cyclohexanecarboxylate |
| SMILES | CN(C)c1ccc(NC(=O)COC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H24N2O3/c1-19(2)15-10-8-14(9-11-15)18-16(20)12-22-17(21)13-6-4-3-5-7-13/h8-11,13H,3-7,12H2,1-2H3,(H,18,20) |
| InChIKey | GBDMGTUESIEJAZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|