C20H30N2O3 — CID 7149751
[2-[4-(dimethylamino)anilino]-2-oxoethyl] 4-cyclohexylbutanoate (PubChem CID 7149751) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] 4-cyclohexylbutanoate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 4-cyclohexylbutanoate |
|---|---|
| PubChem CID | 7149751 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 4-cyclohexylbutanoate |
| SMILES | CN(C)c1ccc(NC(=O)COC(=O)CCCC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H30N2O3/c1-22(2)18-13-11-17(12-14-18)21-19(23)15-25-20(24)10-6-9-16-7-4-3-5-8-16/h11-14,16H,3-10,15H2,1-2H3,(H,21,23) |
| InChIKey | AUQLIKILVBLNPS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|