C19H25NO5 — CID 7554863
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-cyclohexylbutanoate (PubChem CID 7554863) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-cyclohexylbutanoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-cyclohexylbutanoate |
|---|---|
| PubChem CID | 7554863 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-cyclohexylbutanoate |
| SMILES | O=C(COC(=O)CCCC1CCCCC1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H25NO5/c21-18(20-15-9-10-16-17(11-15)25-13-24-16)12-23-19(22)8-4-7-14-5-2-1-3-6-14/h9-11,14H,1-8,12-13H2,(H,20,21) |
| InChIKey | IGAKQEKOZPGCBH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |