C22H30N2O4 — CID 24567250
[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 4-cyclohexylbutanoate (PubChem CID 24567250) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 4-cyclohexylbutanoate.
| Compound Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 4-cyclohexylbutanoate |
|---|---|
| PubChem CID | 24567250 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 4-cyclohexylbutanoate |
| SMILES | O=C(COC(=O)CCCC1CCCCC1)Nc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C22H30N2O4/c25-20(16-28-22(27)13-4-9-17-7-2-1-3-8-17)23-18-10-5-11-19(15-18)24-14-6-12-21(24)26/h5,10-11,15,17H,1-4,6-9,12-14,16H2,(H,23,25) |
| InChIKey | FJRFWYWVWDAEGX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |