C20H20N2O5 — CID 36572037
[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 4-(hydroxymethyl)benzoate (PubChem CID 36572037) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 4-(hydroxymethyl)benzoate.
| Compound Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 4-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 36572037 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 4-(hydroxymethyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(CO)cc1)Nc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C20H20N2O5/c23-12-14-6-8-15(9-7-14)20(26)27-13-18(24)21-16-3-1-4-17(11-16)22-10-2-5-19(22)25/h1,3-4,6-9,11,23H,2,5,10,12-13H2,(H,21,24) |
| InChIKey | OYUDQRHKFVBIPP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |