C19H24N2O4 — CID 9416191
[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl] cyclohexanecarboxylate (PubChem CID 9416191) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl] cyclohexanecarboxylate.
| Compound Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 9416191 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl] cyclohexanecarboxylate |
| SMILES | O=C(COC(=O)C1CCCCC1)Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C19H24N2O4/c22-17(13-25-19(24)14-5-2-1-3-6-14)20-15-8-10-16(11-9-15)21-12-4-7-18(21)23/h8-11,14H,1-7,12-13H2,(H,20,22) |
| InChIKey | JINTUJYZVUBDGP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |