C19H20N2O4S — CID 8601952
[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl] 3-thiophen-2-ylpropanoate (PubChem CID 8601952) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl] 3-thiophen-2-ylpropanoate.
| Compound Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl] 3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 8601952 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl] 3-thiophen-2-ylpropanoate |
| SMILES | O=C(COC(=O)CCc1cccs1)Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c22-17(13-25-19(24)10-9-16-3-2-12-26-16)20-14-5-7-15(8-6-14)21-11-1-4-18(21)23/h2-3,5-8,12H,1,4,9-11,13H2,(H,20,22) |
| InChIKey | UVPHYIKYVVZQIR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |