C19H19NO4S — CID 8934953
[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 3-thiophen-2-ylpropanoate (PubChem CID 8934953) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 3-thiophen-2-ylpropanoate.
| Compound Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 8934953 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 3-thiophen-2-ylpropanoate |
| SMILES | O=C(CCc1cccs1)OCC(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C19H19NO4S/c21-17(13-24-19(23)10-9-16-3-2-12-25-16)14-5-7-15(8-6-14)20-11-1-4-18(20)22/h2-3,5-8,12H,1,4,9-11,13H2 |
| InChIKey | QUORZPUIUIDHMF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |