C18H19N3O6S2 — CID 43065278
[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-(thiophen-2-ylsulfonylamino)acetate (PubChem CID 43065278) has the molecular formula C18H19N3O6S2 and a molecular weight of 437.50 g/mol. Its IUPAC name is [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-(thiophen-2-ylsulfonylamino)acetate.
| Compound Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-(thiophen-2-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 43065278 |
| Molecular Formula | C18H19N3O6S2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | [2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl] 2-(thiophen-2-ylsulfonylamino)acetate |
| SMILES | O=C(COC(=O)CNS(=O)(=O)c1cccs1)Nc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C18H19N3O6S2/c22-15(12-27-17(24)11-19-29(25,26)18-7-3-9-28-18)20-13-4-1-5-14(10-13)21-8-2-6-16(21)23/h1,3-5,7,9-10,19H,2,6,8,11-12H2,(H,20,22) |
| InChIKey | BFYOKOVYVSCBKI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |