C15H15N3O7S2 — CID 46458891
[2-(4-methyl-3-nitroanilino)-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)acetate (PubChem CID 46458891) has the molecular formula C15H15N3O7S2 and a molecular weight of 413.43 g/mol. Its IUPAC name is [2-(4-methyl-3-nitroanilino)-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)acetate.
| Compound Name | [2-(4-methyl-3-nitroanilino)-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 46458891 |
| Molecular Formula | C15H15N3O7S2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | [2-(4-methyl-3-nitroanilino)-2-oxoethyl] 2-(thiophen-2-ylsulfonylamino)acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CNS(=O)(=O)c2cccs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N3O7S2/c1-10-4-5-11(7-12(10)18(21)22)17-13(19)9-25-14(20)8-16-27(23,24)15-3-2-6-26-15/h2-7,16H,8-9H2,1H3,(H,17,19) |
| InChIKey | BFHSCEURHLYBJG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|