C18H26N2O3S2 — CID 7762043
[2-[4-(dimethylamino)anilino]-2-oxoethyl] 5-[(3S)-dithiolan-3-yl]pentanoate (PubChem CID 7762043) has the molecular formula C18H26N2O3S2 and a molecular weight of 382.55 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] 5-[(3S)-dithiolan-3-yl]pentanoate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 5-[(3S)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 7762043 |
| Molecular Formula | C18H26N2O3S2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 5-[(3S)-dithiolan-3-yl]pentanoate |
| SMILES | CN(C)c1ccc(NC(=O)COC(=O)CCCC[C@H]2CCSS2)cc1 |
| InChI | InChI=1S/C18H26N2O3S2/c1-20(2)15-9-7-14(8-10-15)19-17(21)13-23-18(22)6-4-3-5-16-11-12-24-25-16/h7-10,16H,3-6,11-13H2,1-2H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | CUCOIMHWYSMHJA-INIZCTEOSA-N |
| XLogP | 3.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|