C17H22FNO3S2 — CID 7963134
[(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 5-[(3R)-dithiolan-3-yl]pentanoate (PubChem CID 7963134) has the molecular formula C17H22FNO3S2 and a molecular weight of 371.50 g/mol. Its IUPAC name is [(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 5-[(3R)-dithiolan-3-yl]pentanoate.
| Compound Name | [(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 5-[(3R)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 7963134 |
| Molecular Formula | C17H22FNO3S2 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | [(2R)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 5-[(3R)-dithiolan-3-yl]pentanoate |
| SMILES | C[C@@H](OC(=O)CCCC[C@@H]1CCSS1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FNO3S2/c1-12(17(21)19-14-8-6-13(18)7-9-14)22-16(20)5-3-2-4-15-10-11-23-24-15/h6-9,12,15H,2-5,10-11H2,1H3,(H,19,21)/t12-,15-/m1/s1 |
| InChIKey | FEVCALJHPMBUDO-IUODEOHRSA-N |
| XLogP | 4.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|