C19H25NO4S2 — CID 8883461
[(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate (PubChem CID 8883461) has the molecular formula C19H25NO4S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate.
| Compound Name | [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 8883461 |
| Molecular Formula | C19H25NO4S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate |
| SMILES | CC(=O)c1ccccc1NC(=O)[C@@H](C)OC(=O)CCCC[C@H]1CCSS1 |
| InChI | InChI=1S/C19H25NO4S2/c1-13(21)16-8-4-5-9-17(16)20-19(23)14(2)24-18(22)10-6-3-7-15-11-12-25-26-15/h4-5,8-9,14-15H,3,6-7,10-12H2,1-2H3,(H,20,23)/t14-,15+/m1/s1 |
| InChIKey | YPASKVJCHFCBMD-CABCVRRESA-N |
| XLogP | 4.47 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|