C19H27NO4S2 — CID 7963109
[(2R)-1-[(4-methoxyphenyl)methylamino]-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate (PubChem CID 7963109) has the molecular formula C19H27NO4S2 and a molecular weight of 397.56 g/mol. Its IUPAC name is [(2R)-1-[(4-methoxyphenyl)methylamino]-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate.
| Compound Name | [(2R)-1-[(4-methoxyphenyl)methylamino]-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 7963109 |
| Molecular Formula | C19H27NO4S2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | [(2R)-1-[(4-methoxyphenyl)methylamino]-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate |
| SMILES | COc1ccc(CNC(=O)[C@@H](C)OC(=O)CCCC[C@H]2CCSS2)cc1 |
| InChI | InChI=1S/C19H27NO4S2/c1-14(19(22)20-13-15-7-9-16(23-2)10-8-15)24-18(21)6-4-3-5-17-11-12-25-26-17/h7-10,14,17H,3-6,11-13H2,1-2H3,(H,20,22)/t14-,17+/m1/s1 |
| InChIKey | MHQBWYVJDNCTQS-PBHICJAKSA-N |
| XLogP | 3.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|