C17H21F2NO3S2 — CID 8883150
[(2S)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate (PubChem CID 8883150) has the molecular formula C17H21F2NO3S2 and a molecular weight of 389.49 g/mol. Its IUPAC name is [(2S)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate.
| Compound Name | [(2S)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 8883150 |
| Molecular Formula | C17H21F2NO3S2 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | [(2S)-1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate |
| SMILES | C[C@H](OC(=O)CCCC[C@H]1CCSS1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H21F2NO3S2/c1-11(17(22)20-15-7-6-12(18)10-14(15)19)23-16(21)5-3-2-4-13-8-9-24-25-13/h6-7,10-11,13H,2-5,8-9H2,1H3,(H,20,22)/t11-,13-/m0/s1 |
| InChIKey | SQASOUSVGCJUDA-AAEUAGOBSA-N |
| XLogP | 4.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|