C17H22ClNO3S2 — CID 8882863
[(2R)-1-(2-chloroanilino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate (PubChem CID 8882863) has the molecular formula C17H22ClNO3S2 and a molecular weight of 387.95 g/mol. Its IUPAC name is [(2R)-1-(2-chloroanilino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate.
| Compound Name | [(2R)-1-(2-chloroanilino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 8882863 |
| Molecular Formula | C17H22ClNO3S2 |
| Molecular Weight | 387.95 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [(2R)-1-(2-chloroanilino)-1-oxopropan-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate |
| SMILES | C[C@@H](OC(=O)CCCC[C@H]1CCSS1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H22ClNO3S2/c1-12(17(21)19-15-8-4-3-7-14(15)18)22-16(20)9-5-2-6-13-10-11-23-24-13/h3-4,7-8,12-13H,2,5-6,9-11H2,1H3,(H,19,21)/t12-,13+/m1/s1 |
| InChIKey | UHBYAYCJWKBJJL-OLZOCXBDSA-N |
| XLogP | 4.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.95 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|