C17H25NO3S2 — CID 51219100
N-[(3,4-dimethoxyphenyl)methyl]-5-(dithiolan-3-yl)pentanamide (PubChem CID 51219100) has the molecular formula C17H25NO3S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-5-(dithiolan-3-yl)pentanamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-5-(dithiolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 51219100 |
| Molecular Formula | C17H25NO3S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-5-(dithiolan-3-yl)pentanamide |
| SMILES | COc1ccc(CNC(=O)CCCCC2CCSS2)cc1OC |
| InChI | InChI=1S/C17H25NO3S2/c1-20-15-8-7-13(11-16(15)21-2)12-18-17(19)6-4-3-5-14-9-10-22-23-14/h7-8,11,14H,3-6,9-10,12H2,1-2H3,(H,18,19) |
| InChIKey | OPEYBMRBGNVQMR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|