C28H36O7S2 — CID 155755599
[2-methoxy-5-[(5,6,7-trimethoxy-3,4-dihydro-2H-chromen-3-yl)methyl]phenyl] 5-(dithiolan-3-yl)pentanoate (PubChem CID 155755599) has the molecular formula C28H36O7S2 and a molecular weight of 548.72 g/mol. Its IUPAC name is [2-methoxy-5-[(5,6,7-trimethoxy-3,4-dihydro-2H-chromen-3-yl)methyl]phenyl] 5-(dithiolan-3-yl)pentanoate.
| Compound Name | [2-methoxy-5-[(5,6,7-trimethoxy-3,4-dihydro-2H-chromen-3-yl)methyl]phenyl] 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 155755599 |
| Molecular Formula | C28H36O7S2 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | [2-methoxy-5-[(5,6,7-trimethoxy-3,4-dihydro-2H-chromen-3-yl)methyl]phenyl] 5-(dithiolan-3-yl)pentanoate |
| SMILES | COc1ccc(CC2COc3cc(OC)c(OC)c(OC)c3C2)cc1OC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C28H36O7S2/c1-30-22-10-9-18(15-24(22)35-26(29)8-6-5-7-20-11-12-36-37-20)13-19-14-21-23(34-17-19)16-25(31-2)28(33-4)27(21)32-3/h9-10,15-16,19-20H,5-8,11-14,17H2,1-4H3 |
| InChIKey | KLYHMWZTHPKKJC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|