C25H32O6 — CID 71712571
[4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] butanoate (PubChem CID 71712571) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] butanoate.
| Compound Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] butanoate |
|---|---|
| PubChem CID | 71712571 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(C[C@H]2COC[C@@H]2Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C25H32O6/c1-5-6-25(26)31-22-10-8-18(14-24(22)29-4)12-20-16-30-15-19(20)11-17-7-9-21(27-2)23(13-17)28-3/h7-10,13-14,19-20H,5-6,11-12,15-16H2,1-4H3/t19-,20-/m0/s1 |
| InChIKey | DVJCFPKCPZBKIY-PMACEKPBSA-N |
| XLogP | 4.47 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|