C29H32O7 — CID 71712574
[4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] 4-methoxybenzoate (PubChem CID 71712574) has the molecular formula C29H32O7 and a molecular weight of 492.57 g/mol. Its IUPAC name is [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] 4-methoxybenzoate.
| Compound Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 71712574 |
| Molecular Formula | C29H32O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [4-[[(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methyl]-2-methoxyphenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C[C@H]3COC[C@@H]3Cc3ccc(OC)c(OC)c3)cc2OC)cc1 |
| InChI | InChI=1S/C29H32O7/c1-31-24-9-7-21(8-10-24)29(30)36-26-12-6-20(16-28(26)34-4)14-23-18-35-17-22(23)13-19-5-11-25(32-2)27(15-19)33-3/h5-12,15-16,22-23H,13-14,17-18H2,1-4H3/t22-,23-/m0/s1 |
| InChIKey | UTKTYGFPMMVFMO-GOTSBHOMSA-N |
| XLogP | 4.99 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|