C20H24O3 — CID 10267530
(3S,4S)-3,4-bis[(3-methoxyphenyl)methyl]oxolane (PubChem CID 10267530) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3S,4S)-3,4-bis[(3-methoxyphenyl)methyl]oxolane.
| Compound Name | (3S,4S)-3,4-bis[(3-methoxyphenyl)methyl]oxolane |
|---|---|
| PubChem CID | 10267530 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (3S,4S)-3,4-bis[(3-methoxyphenyl)methyl]oxolane |
| SMILES | COc1cccc(C[C@@H]2COC[C@H]2Cc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C20H24O3/c1-21-19-7-3-5-15(11-19)9-17-13-23-14-18(17)10-16-6-4-8-20(12-16)22-2/h3-8,11-12,17-18H,9-10,13-14H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | XOMXFRGFFGQGKM-QZTJIDSGSA-N |
| XLogP | 3.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |