C21H24O4 — CID 59801682
4-[(3-ethoxyphenyl)methyl]-3-[(3-methoxyphenyl)methyl]oxolan-2-one (PubChem CID 59801682) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 4-[(3-ethoxyphenyl)methyl]-3-[(3-methoxyphenyl)methyl]oxolan-2-one.
| Compound Name | 4-[(3-ethoxyphenyl)methyl]-3-[(3-methoxyphenyl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 59801682 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-[(3-ethoxyphenyl)methyl]-3-[(3-methoxyphenyl)methyl]oxolan-2-one |
| SMILES | CCOc1cccc(CC2COC(=O)C2Cc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C21H24O4/c1-3-24-19-9-5-6-15(12-19)10-17-14-25-21(22)20(17)13-16-7-4-8-18(11-16)23-2/h4-9,11-12,17,20H,3,10,13-14H2,1-2H3 |
| InChIKey | HEFQTQPCMSKKKO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |