C34H34O6 — CID 158275652
3,4-bis[(3-methoxy-4-phenylmethoxyphenyl)(113C)methyl]oxolan-2-one (PubChem CID 158275652) has the molecular formula C34H34O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 3,4-bis[(3-methoxy-4-phenylmethoxyphenyl)(113C)methyl]oxolan-2-one.
| Compound Name | 3,4-bis[(3-methoxy-4-phenylmethoxyphenyl)(113C)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 158275652 |
| Molecular Formula | C34H34O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 3,4-bis[(3-methoxy-4-phenylmethoxyphenyl)(113C)methyl]oxolan-2-one |
| SMILES | COc1cc([13CH2]C2COC(=O)C2[13CH2]c2ccc(OCc3ccccc3)c(OC)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C34H34O6/c1-36-32-19-26(13-15-30(32)38-21-24-9-5-3-6-10-24)17-28-23-40-34(35)29(28)18-27-14-16-31(33(20-27)37-2)39-22-25-11-7-4-8-12-25/h3-16,19-20,28-29H,17-18,21-23H2,1-2H3/i17+1,18+1 |
| InChIKey | GJONVZSUXWNNKA-VJNPICPZSA-N |
| XLogP | 6.44 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |