C19H20O4 — CID 158061300
4-[(3-methoxy-4-phenylmethoxyphenyl)(113C)methyl]oxolan-2-one (PubChem CID 158061300) has the molecular formula C19H20O4 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-[(3-methoxy-4-phenylmethoxyphenyl)(113C)methyl]oxolan-2-one.
| Compound Name | 4-[(3-methoxy-4-phenylmethoxyphenyl)(113C)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 158061300 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 4-[(3-methoxy-4-phenylmethoxyphenyl)(113C)methyl]oxolan-2-one |
| SMILES | COc1cc([13CH2]C2COC(=O)C2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C19H20O4/c1-21-18-10-15(9-16-11-19(20)23-13-16)7-8-17(18)22-12-14-5-3-2-4-6-14/h2-8,10,16H,9,11-13H2,1H3/i9+1 |
| InChIKey | FKRJBUYHQOXRCE-QBZHADDCSA-N |
| XLogP | 3.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |