C11H13NO2 — CID 174980378
4-[(3-aminophenyl)methyl]oxolan-2-one (PubChem CID 174980378) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-[(3-aminophenyl)methyl]oxolan-2-one.
| Compound Name | 4-[(3-aminophenyl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 174980378 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 4-[(3-aminophenyl)methyl]oxolan-2-one |
| SMILES | Nc1cccc(CC2COC(=O)C2)c1 |
| InChI | InChI=1S/C11H13NO2/c12-10-3-1-2-8(5-10)4-9-6-11(13)14-7-9/h1-3,5,9H,4,6-7,12H2 |
| InChIKey | DHYUMYVSPSZAKD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|