C22H27NO4 — CID 66549553
4-[(3,4-dimethoxyphenyl)methyl]-3-[[4-(dimethylamino)phenyl]methyl]oxolan-2-one (PubChem CID 66549553) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methyl]-3-[[4-(dimethylamino)phenyl]methyl]oxolan-2-one.
| Compound Name | 4-[(3,4-dimethoxyphenyl)methyl]-3-[[4-(dimethylamino)phenyl]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 66549553 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)methyl]-3-[[4-(dimethylamino)phenyl]methyl]oxolan-2-one |
| SMILES | COc1ccc(CC2COC(=O)C2Cc2ccc(N(C)C)cc2)cc1OC |
| InChI | InChI=1S/C22H27NO4/c1-23(2)18-8-5-15(6-9-18)12-19-17(14-27-22(19)24)11-16-7-10-20(25-3)21(13-16)26-4/h5-10,13,17,19H,11-12,14H2,1-4H3 |
| InChIKey | WGNXKEOCXIFXRB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|