C20H22O4 — CID 11580724
(3R,4R)-3,4-bis[(3-methoxyphenyl)(113C)methyl](213C)oxolan-2-one (PubChem CID 11580724) has the molecular formula C20H22O4 and a molecular weight of 329.37 g/mol. Its IUPAC name is (3R,4R)-3,4-bis[(3-methoxyphenyl)(113C)methyl](213C)oxolan-2-one.
| Compound Name | (3R,4R)-3,4-bis[(3-methoxyphenyl)(113C)methyl](213C)oxolan-2-one |
|---|---|
| PubChem CID | 11580724 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (3R,4R)-3,4-bis[(3-methoxyphenyl)(113C)methyl](213C)oxolan-2-one |
| SMILES | COc1cccc([13CH2][C@H]2CO[13C](=O)[C@@H]2[13CH2]c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C20H22O4/c1-22-17-7-3-5-14(10-17)9-16-13-24-20(21)19(16)12-15-6-4-8-18(11-15)23-2/h3-8,10-11,16,19H,9,12-13H2,1-2H3/t16-,19+/m0/s1/i9+1,12+1,20+1 |
| InChIKey | RLYSAJZJSSKQCM-YXDZAYSBSA-N |
| XLogP | 3.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |