C29H39NO7 — CID 118653524
tert-butyl N-[(3S,7R,8R,9S)-7,8-bis[(3-methoxyphenyl)methyl]-9-methyl-2-oxo-1,5-dioxonan-3-yl]carbamate (PubChem CID 118653524) has the molecular formula C29H39NO7 and a molecular weight of 513.63 g/mol. Its IUPAC name is tert-butyl N-[(3S,7R,8R,9S)-7,8-bis[(3-methoxyphenyl)methyl]-9-methyl-2-oxo-1,5-dioxonan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,7R,8R,9S)-7,8-bis[(3-methoxyphenyl)methyl]-9-methyl-2-oxo-1,5-dioxonan-3-yl]carbamate |
|---|---|
| PubChem CID | 118653524 |
| Molecular Formula | C29H39NO7 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | tert-butyl N-[(3S,7R,8R,9S)-7,8-bis[(3-methoxyphenyl)methyl]-9-methyl-2-oxo-1,5-dioxonan-3-yl]carbamate |
| SMILES | COc1cccc(C[C@H]2COC[C@H](NC(=O)OC(C)(C)C)C(=O)O[C@@H](C)[C@@H]2Cc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C29H39NO7/c1-19-25(16-21-10-8-12-24(15-21)34-6)22(13-20-9-7-11-23(14-20)33-5)17-35-18-26(27(31)36-19)30-28(32)37-29(2,3)4/h7-12,14-15,19,22,25-26H,13,16-18H2,1-6H3,(H,30,32)/t19-,22-,25-,26-/m0/s1 |
| InChIKey | QXYQEORURVJKOZ-UBZHHNTMSA-N |
| XLogP | 4.58 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |