C29H33F6NO6 — CID 118653537
tert-butyl N-[(3S,7R,8R,9S)-9-methyl-2-oxo-8-[[4-(trifluoromethoxy)phenyl]methyl]-7-[[4-(trifluoromethyl)phenyl]methyl]-1,5-dioxonan-3-yl]carbamate (PubChem CID 118653537) has the molecular formula C29H33F6NO6 and a molecular weight of 605.57 g/mol. Its IUPAC name is tert-butyl N-[(3S,7R,8R,9S)-9-methyl-2-oxo-8-[[4-(trifluoromethoxy)phenyl]methyl]-7-[[4-(trifluoromethyl)phenyl]methyl]-1,5-dioxonan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,7R,8R,9S)-9-methyl-2-oxo-8-[[4-(trifluoromethoxy)phenyl]methyl]-7-[[4-(trifluoromethyl)phenyl]methyl]-1,5-dioxonan-3-yl]carbamate |
|---|---|
| PubChem CID | 118653537 |
| Molecular Formula | C29H33F6NO6 |
| Molecular Weight | 605.57 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | tert-butyl N-[(3S,7R,8R,9S)-9-methyl-2-oxo-8-[[4-(trifluoromethoxy)phenyl]methyl]-7-[[4-(trifluoromethyl)phenyl]methyl]-1,5-dioxonan-3-yl]carbamate |
| SMILES | C[C@@H]1OC(=O)[C@@H](NC(=O)OC(C)(C)C)COC[C@@H](Cc2ccc(C(F)(F)F)cc2)[C@H]1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C29H33F6NO6/c1-17-23(14-19-7-11-22(12-8-19)41-29(33,34)35)20(13-18-5-9-21(10-6-18)28(30,31)32)15-39-16-24(25(37)40-17)36-26(38)42-27(2,3)4/h5-12,17,20,23-24H,13-16H2,1-4H3,(H,36,38)/t17-,20+,23-,24-/m0/s1 |
| InChIKey | QKJXIMBTIGCTOU-UHVVYFEBSA-N |
| XLogP | 6.48 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |