C26H33NO6 — CID 123172116
tert-butyl N-(7-benzyl-9-methyl-2-oxo-8-phenoxy-1,5-dioxonan-3-yl)carbamate (PubChem CID 123172116) has the molecular formula C26H33NO6 and a molecular weight of 455.55 g/mol. Its IUPAC name is tert-butyl N-(7-benzyl-9-methyl-2-oxo-8-phenoxy-1,5-dioxonan-3-yl)carbamate.
| Compound Name | tert-butyl N-(7-benzyl-9-methyl-2-oxo-8-phenoxy-1,5-dioxonan-3-yl)carbamate |
|---|---|
| PubChem CID | 123172116 |
| Molecular Formula | C26H33NO6 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | tert-butyl N-(7-benzyl-9-methyl-2-oxo-8-phenoxy-1,5-dioxonan-3-yl)carbamate |
| SMILES | CC1OC(=O)C(NC(=O)OC(C)(C)C)COCC(Cc2ccccc2)C1Oc1ccccc1 |
| InChI | InChI=1S/C26H33NO6/c1-18-23(32-21-13-9-6-10-14-21)20(15-19-11-7-5-8-12-19)16-30-17-22(24(28)31-18)27-25(29)33-26(2,3)4/h5-14,18,20,22-23H,15-17H2,1-4H3,(H,27,29) |
| InChIKey | DOQZDRULPLICFN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |