C23H35NO6 — CID 123976019
tert-butyl N-(8-butyl-9-methyl-2-oxo-7-phenoxy-1,5-dioxonan-3-yl)carbamate (PubChem CID 123976019) has the molecular formula C23H35NO6 and a molecular weight of 421.53 g/mol. Its IUPAC name is tert-butyl N-(8-butyl-9-methyl-2-oxo-7-phenoxy-1,5-dioxonan-3-yl)carbamate.
| Compound Name | tert-butyl N-(8-butyl-9-methyl-2-oxo-7-phenoxy-1,5-dioxonan-3-yl)carbamate |
|---|---|
| PubChem CID | 123976019 |
| Molecular Formula | C23H35NO6 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | tert-butyl N-(8-butyl-9-methyl-2-oxo-7-phenoxy-1,5-dioxonan-3-yl)carbamate |
| SMILES | CCCCC1C(C)OC(=O)C(NC(=O)OC(C)(C)C)COCC1Oc1ccccc1 |
| InChI | InChI=1S/C23H35NO6/c1-6-7-13-18-16(2)28-21(25)19(24-22(26)30-23(3,4)5)14-27-15-20(18)29-17-11-9-8-10-12-17/h8-12,16,18-20H,6-7,13-15H2,1-5H3,(H,24,26) |
| InChIKey | ZVUPPGTYFIAQDJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |