C24H37NO5 — CID 118199379
tert-butyl N-[(3S,7S,8S,9S)-8-benzyl-9-methyl-2-oxo-7-propoxyoxonan-3-yl]carbamate (PubChem CID 118199379) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is tert-butyl N-[(3S,7S,8S,9S)-8-benzyl-9-methyl-2-oxo-7-propoxyoxonan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,7S,8S,9S)-8-benzyl-9-methyl-2-oxo-7-propoxyoxonan-3-yl]carbamate |
|---|---|
| PubChem CID | 118199379 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | tert-butyl N-[(3S,7S,8S,9S)-8-benzyl-9-methyl-2-oxo-7-propoxyoxonan-3-yl]carbamate |
| SMILES | CCCO[C@H]1CCC[C@H](NC(=O)OC(C)(C)C)C(=O)O[C@@H](C)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H37NO5/c1-6-15-28-21-14-10-13-20(25-23(27)30-24(3,4)5)22(26)29-17(2)19(21)16-18-11-8-7-9-12-18/h7-9,11-12,17,19-21H,6,10,13-16H2,1-5H3,(H,25,27)/t17-,19-,20-,21-/m0/s1 |
| InChIKey | JDIYOBYTZGZLJL-VMXMFDLUSA-N |
| XLogP | 4.65 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |