C30H41NO4 — CID 123800014
tert-butyl N-[8-benzyl-9-methyl-2-oxo-7-(3-phenylpropyl)oxonan-3-yl]carbamate (PubChem CID 123800014) has the molecular formula C30H41NO4 and a molecular weight of 479.66 g/mol. Its IUPAC name is tert-butyl N-[8-benzyl-9-methyl-2-oxo-7-(3-phenylpropyl)oxonan-3-yl]carbamate.
| Compound Name | tert-butyl N-[8-benzyl-9-methyl-2-oxo-7-(3-phenylpropyl)oxonan-3-yl]carbamate |
|---|---|
| PubChem CID | 123800014 |
| Molecular Formula | C30H41NO4 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | tert-butyl N-[8-benzyl-9-methyl-2-oxo-7-(3-phenylpropyl)oxonan-3-yl]carbamate |
| SMILES | CC1OC(=O)C(NC(=O)OC(C)(C)C)CCCC(CCCc2ccccc2)C1Cc1ccccc1 |
| InChI | InChI=1S/C30H41NO4/c1-22-26(21-24-15-9-6-10-16-24)25(18-11-17-23-13-7-5-8-14-23)19-12-20-27(28(32)34-22)31-29(33)35-30(2,3)4/h5-10,13-16,22,25-27H,11-12,17-21H2,1-4H3,(H,31,33) |
| InChIKey | IVVMPNYVLTYHNX-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |