C21H31NO5 — CID 145114959
tert-butyl N-[(3S)-8-benzyl-10-methyl-2-oxo-1,5-dioxecan-3-yl]carbamate (PubChem CID 145114959) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is tert-butyl N-[(3S)-8-benzyl-10-methyl-2-oxo-1,5-dioxecan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-8-benzyl-10-methyl-2-oxo-1,5-dioxecan-3-yl]carbamate |
|---|---|
| PubChem CID | 145114959 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | tert-butyl N-[(3S)-8-benzyl-10-methyl-2-oxo-1,5-dioxecan-3-yl]carbamate |
| SMILES | CC1CC(Cc2ccccc2)CCOC[C@H](NC(=O)OC(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C21H31NO5/c1-15-12-17(13-16-8-6-5-7-9-16)10-11-25-14-18(19(23)26-15)22-20(24)27-21(2,3)4/h5-9,15,17-18H,10-14H2,1-4H3,(H,22,24)/t15?,17?,18-/m0/s1 |
| InChIKey | BPMUDJTYFGYTBX-VJFUWPCTSA-N |
| XLogP | 3.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |