C19H27NO5 — CID 144995887
benzyl N-[(3S)-9-methyl-2-oxo-7-propyl-1,5-dioxonan-3-yl]carbamate (PubChem CID 144995887) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is benzyl N-[(3S)-9-methyl-2-oxo-7-propyl-1,5-dioxonan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-9-methyl-2-oxo-7-propyl-1,5-dioxonan-3-yl]carbamate |
|---|---|
| PubChem CID | 144995887 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | benzyl N-[(3S)-9-methyl-2-oxo-7-propyl-1,5-dioxonan-3-yl]carbamate |
| SMILES | CCCC1COC[C@H](NC(=O)OCc2ccccc2)C(=O)OC(C)C1 |
| InChI | InChI=1S/C19H27NO5/c1-3-7-16-10-14(2)25-18(21)17(13-23-11-16)20-19(22)24-12-15-8-5-4-6-9-15/h4-6,8-9,14,16-17H,3,7,10-13H2,1-2H3,(H,20,22)/t14?,16?,17-/m0/s1 |
| InChIKey | CFRZRVXZBSEQJF-PREGVCBESA-N |
| XLogP | 3.05 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |