C27H34N2O8 — CID 144995923
[4-methoxy-2-[[(3S)-9-methyl-2-oxo-7-(3-phenylpropyl)-1,5-dioxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate (PubChem CID 144995923) has the molecular formula C27H34N2O8 and a molecular weight of 514.58 g/mol. Its IUPAC name is [4-methoxy-2-[[(3S)-9-methyl-2-oxo-7-(3-phenylpropyl)-1,5-dioxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate.
| Compound Name | [4-methoxy-2-[[(3S)-9-methyl-2-oxo-7-(3-phenylpropyl)-1,5-dioxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate |
|---|---|
| PubChem CID | 144995923 |
| Molecular Formula | C27H34N2O8 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | [4-methoxy-2-[[(3S)-9-methyl-2-oxo-7-(3-phenylpropyl)-1,5-dioxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate |
| SMILES | COc1ccnc(C(=O)N[C@H]2COCC(CCCc3ccccc3)CC(C)OC2=O)c1OCOC(C)=O |
| InChI | InChI=1S/C27H34N2O8/c1-18-14-21(11-7-10-20-8-5-4-6-9-20)15-34-16-22(27(32)37-18)29-26(31)24-25(36-17-35-19(2)30)23(33-3)12-13-28-24/h4-6,8-9,12-13,18,21-22H,7,10-11,14-17H2,1-3H3,(H,29,31)/t18?,21?,22-/m0/s1 |
| InChIKey | SLFLPOXQBLAQAK-UDJZJCJKSA-N |
| XLogP | 3.08 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|