C31H40N2O9 — CID 123569339
[2-[(7-benzyl-8-cyclohexyloxy-9-methyl-2-oxo-1,5-dioxonan-3-yl)carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate (PubChem CID 123569339) has the molecular formula C31H40N2O9 and a molecular weight of 584.67 g/mol. Its IUPAC name is [2-[(7-benzyl-8-cyclohexyloxy-9-methyl-2-oxo-1,5-dioxonan-3-yl)carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate.
| Compound Name | [2-[(7-benzyl-8-cyclohexyloxy-9-methyl-2-oxo-1,5-dioxonan-3-yl)carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate |
|---|---|
| PubChem CID | 123569339 |
| Molecular Formula | C31H40N2O9 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | [2-[(7-benzyl-8-cyclohexyloxy-9-methyl-2-oxo-1,5-dioxonan-3-yl)carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate |
| SMILES | COc1ccnc(C(=O)NC2COCC(Cc3ccccc3)C(OC3CCCCC3)C(C)OC2=O)c1OCOC(C)=O |
| InChI | InChI=1S/C31H40N2O9/c1-20-28(42-24-12-8-5-9-13-24)23(16-22-10-6-4-7-11-22)17-38-18-25(31(36)41-20)33-30(35)27-29(40-19-39-21(2)34)26(37-3)14-15-32-27/h4,6-7,10-11,14-15,20,23-25,28H,5,8-9,12-13,16-19H2,1-3H3,(H,33,35) |
| InChIKey | JDFCVASVIQPAFH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|