C32H36N2O7 — CID 123466425
[2-[(7-benzyl-9-methyl-2-oxo-8-phenyloxonan-3-yl)carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate (PubChem CID 123466425) has the molecular formula C32H36N2O7 and a molecular weight of 560.65 g/mol. Its IUPAC name is [2-[(7-benzyl-9-methyl-2-oxo-8-phenyloxonan-3-yl)carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate.
| Compound Name | [2-[(7-benzyl-9-methyl-2-oxo-8-phenyloxonan-3-yl)carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate |
|---|---|
| PubChem CID | 123466425 |
| Molecular Formula | C32H36N2O7 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | [2-[(7-benzyl-9-methyl-2-oxo-8-phenyloxonan-3-yl)carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl acetate |
| SMILES | COc1ccnc(C(=O)NC2CCCC(Cc3ccccc3)C(c3ccccc3)C(C)OC2=O)c1OCOC(C)=O |
| InChI | InChI=1S/C32H36N2O7/c1-21-28(24-13-8-5-9-14-24)25(19-23-11-6-4-7-12-23)15-10-16-26(32(37)41-21)34-31(36)29-30(40-20-39-22(2)35)27(38-3)17-18-33-29/h4-9,11-14,17-18,21,25-26,28H,10,15-16,19-20H2,1-3H3,(H,34,36) |
| InChIKey | GPHFGVCQBSJOLM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|