C31H42N2O8 — CID 123387599
[4-methoxy-2-[[9-methyl-8-(3-methylbutyl)-2-oxo-7-phenylmethoxyoxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate (PubChem CID 123387599) has the molecular formula C31H42N2O8 and a molecular weight of 570.68 g/mol. Its IUPAC name is [4-methoxy-2-[[9-methyl-8-(3-methylbutyl)-2-oxo-7-phenylmethoxyoxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate.
| Compound Name | [4-methoxy-2-[[9-methyl-8-(3-methylbutyl)-2-oxo-7-phenylmethoxyoxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate |
|---|---|
| PubChem CID | 123387599 |
| Molecular Formula | C31H42N2O8 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | [4-methoxy-2-[[9-methyl-8-(3-methylbutyl)-2-oxo-7-phenylmethoxyoxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl acetate |
| SMILES | COc1ccnc(C(=O)NC2CCCC(OCc3ccccc3)C(CCC(C)C)C(C)OC2=O)c1OCOC(C)=O |
| InChI | InChI=1S/C31H42N2O8/c1-20(2)14-15-24-21(3)41-31(36)25(12-9-13-26(24)38-18-23-10-7-6-8-11-23)33-30(35)28-29(40-19-39-22(4)34)27(37-5)16-17-32-28/h6-8,10-11,16-17,20-21,24-26H,9,12-15,18-19H2,1-5H3,(H,33,35) |
| InChIKey | NQUIRRGIOFHHEW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|