C32H44N2O8 — CID 123441072
[4-methoxy-2-[[9-methyl-7-(3-methylbutyl)-2-oxo-8-phenoxyoxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate (PubChem CID 123441072) has the molecular formula C32H44N2O8 and a molecular weight of 584.71 g/mol. Its IUPAC name is [4-methoxy-2-[[9-methyl-7-(3-methylbutyl)-2-oxo-8-phenoxyoxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate.
| Compound Name | [4-methoxy-2-[[9-methyl-7-(3-methylbutyl)-2-oxo-8-phenoxyoxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 123441072 |
| Molecular Formula | C32H44N2O8 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | [4-methoxy-2-[[9-methyl-7-(3-methylbutyl)-2-oxo-8-phenoxyoxonan-3-yl]carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)NC2CCCC(CCC(C)C)C(Oc3ccccc3)C(C)OC2=O)c1OCOC(=O)C(C)C |
| InChI | InChI=1S/C32H44N2O8/c1-20(2)15-16-23-11-10-14-25(32(37)41-22(5)28(23)42-24-12-8-7-9-13-24)34-30(35)27-29(26(38-6)17-18-33-27)39-19-40-31(36)21(3)4/h7-9,12-13,17-18,20-23,25,28H,10-11,14-16,19H2,1-6H3,(H,34,35) |
| InChIKey | PWAZJJVSCIIRGY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|