C30H44N2O9 — CID 121460376
[(2S,3R,4R,9S)-9-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]-4-(cyclopentylmethyl)-2-methyl-10-oxooxecan-3-yl] 2-methylpropanoate (PubChem CID 121460376) has the molecular formula C30H44N2O9 and a molecular weight of 576.69 g/mol. Its IUPAC name is [(2S,3R,4R,9S)-9-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]-4-(cyclopentylmethyl)-2-methyl-10-oxooxecan-3-yl] 2-methylpropanoate.
| Compound Name | [(2S,3R,4R,9S)-9-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]-4-(cyclopentylmethyl)-2-methyl-10-oxooxecan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 121460376 |
| Molecular Formula | C30H44N2O9 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | [(2S,3R,4R,9S)-9-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]-4-(cyclopentylmethyl)-2-methyl-10-oxooxecan-3-yl] 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)N[C@H]2CCCC[C@H](CC3CCCC3)[C@@H](OC(=O)C(C)C)[C@H](C)OC2=O)c1OCOC(C)=O |
| InChI | InChI=1S/C30H44N2O9/c1-18(2)29(35)41-26-19(3)40-30(36)23(13-9-8-12-22(26)16-21-10-6-7-11-21)32-28(34)25-27(39-17-38-20(4)33)24(37-5)14-15-31-25/h14-15,18-19,21-23,26H,6-13,16-17H2,1-5H3,(H,32,34)/t19-,22+,23-,26-/m0/s1 |
| InChIKey | AFKMNFZUDZNSRP-AOXNNKNRSA-N |
| XLogP | 4.36 |
| TPSA | 139.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|