C29H35FN2O10 — CID 123367677
[3-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]-8-[(4-fluorophenyl)methyl]-6-methyl-4-oxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 123367677) has the molecular formula C29H35FN2O10 and a molecular weight of 590.60 g/mol. Its IUPAC name is [3-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]-8-[(4-fluorophenyl)methyl]-6-methyl-4-oxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [3-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]-8-[(4-fluorophenyl)methyl]-6-methyl-4-oxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 123367677 |
| Molecular Formula | C29H35FN2O10 |
| Molecular Weight | 590.60 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | [3-[[3-(acetyloxymethoxy)-4-methoxypyridine-2-carbonyl]amino]-8-[(4-fluorophenyl)methyl]-6-methyl-4-oxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)NC2COCC(Cc3ccc(F)cc3)C(OC(=O)C(C)C)C(C)OC2=O)c1OCOC(C)=O |
| InChI | InChI=1S/C29H35FN2O10/c1-16(2)28(35)42-25-17(3)41-29(36)22(14-38-13-20(25)12-19-6-8-21(30)9-7-19)32-27(34)24-26(40-15-39-18(4)33)23(37-5)10-11-31-24/h6-11,16-17,20,22,25H,12-15H2,1-5H3,(H,32,34) |
| InChIKey | AJKVYUJJNYBYPU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 148.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.60 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|