C28H36N2O8 — CID 144995814
[2-[[(3S,7R,8R,9S)-7-benzyl-8,9-dimethyl-2-oxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-methylpropanoate (PubChem CID 144995814) has the molecular formula C28H36N2O8 and a molecular weight of 528.60 g/mol. Its IUPAC name is [2-[[(3S,7R,8R,9S)-7-benzyl-8,9-dimethyl-2-oxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-methylpropanoate.
| Compound Name | [2-[[(3S,7R,8R,9S)-7-benzyl-8,9-dimethyl-2-oxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 144995814 |
| Molecular Formula | C28H36N2O8 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | [2-[[(3S,7R,8R,9S)-7-benzyl-8,9-dimethyl-2-oxo-1,5-dioxonan-3-yl]carbamoyl]-4-methoxy-3-pyridinyl]oxymethyl 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC[C@H](Cc3ccccc3)[C@@H](C)[C@H](C)OC2=O)c1OCOC(=O)C(C)C |
| InChI | InChI=1S/C28H36N2O8/c1-17(2)27(32)37-16-36-25-23(34-5)11-12-29-24(25)26(31)30-22-15-35-14-21(13-20-9-7-6-8-10-20)18(3)19(4)38-28(22)33/h6-12,17-19,21-22H,13-16H2,1-5H3,(H,30,31)/t18-,19-,21-,22-/m0/s1 |
| InChIKey | RXEDKDYEMHTDQK-LGGPRVQUSA-N |
| XLogP | 3.18 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|