C31H38N2O11 — CID 175446229
2-[(3R)-8-benzyl-3-[[4-methoxy-3-(2-methylpropanoyloxymethoxy)pyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl]-2-methylpropanoic acid (PubChem CID 175446229) has the molecular formula C31H38N2O11 and a molecular weight of 614.65 g/mol. Its IUPAC name is 2-[(3R)-8-benzyl-3-[[4-methoxy-3-(2-methylpropanoyloxymethoxy)pyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl]-2-methylpropanoic acid.
| Compound Name | 2-[(3R)-8-benzyl-3-[[4-methoxy-3-(2-methylpropanoyloxymethoxy)pyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175446229 |
| Molecular Formula | C31H38N2O11 |
| Molecular Weight | 614.65 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 2-[(3R)-8-benzyl-3-[[4-methoxy-3-(2-methylpropanoyloxymethoxy)pyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl]-2-methylpropanoic acid |
| SMILES | COc1ccnc(C(=O)N[C@@H]2COC(=O)C(Cc3ccccc3)C(C(C)(C)C(=O)O)C(C)OC2=O)c1OCOC(=O)C(C)C |
| InChI | InChI=1S/C31H38N2O11/c1-17(2)27(35)43-16-42-25-22(40-6)12-13-32-24(25)26(34)33-21-15-41-28(36)20(14-19-10-8-7-9-11-19)23(18(3)44-29(21)37)31(4,5)30(38)39/h7-13,17-18,20-21,23H,14-16H2,1-6H3,(H,33,34)(H,38,39)/t18?,20?,21-,23?/m1/s1 |
| InChIKey | ROKOCJVRGFKJJL-MDUIXZDWSA-N |
| XLogP | 2.80 |
| TPSA | 176.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.65 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|