C31H38N2O12 — CID 20761406
[8-benzyl-3-[[4-methoxy-3-(propoxycarbonyloxymethoxy)pyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 20761406) has the molecular formula C31H38N2O12 and a molecular weight of 630.65 g/mol. Its IUPAC name is [8-benzyl-3-[[4-methoxy-3-(propoxycarbonyloxymethoxy)pyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [8-benzyl-3-[[4-methoxy-3-(propoxycarbonyloxymethoxy)pyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 20761406 |
| Molecular Formula | C31H38N2O12 |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | [8-benzyl-3-[[4-methoxy-3-(propoxycarbonyloxymethoxy)pyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | CCCOC(=O)OCOc1c(OC)ccnc1C(=O)NC1COC(=O)C(Cc2ccccc2)C(OC(=O)C(C)C)C(C)OC1=O |
| InChI | InChI=1S/C31H38N2O12/c1-6-14-40-31(38)43-17-42-26-23(39-5)12-13-32-24(26)27(34)33-22-16-41-29(36)21(15-20-10-8-7-9-11-20)25(19(4)44-30(22)37)45-28(35)18(2)3/h7-13,18-19,21-22,25H,6,14-17H2,1-5H3,(H,33,34) |
| InChIKey | HSBSIKGFIZXTDV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 174.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|