C34H34N2O11 — CID 59989544
[(3S,6S,7R,8R)-8-benzyl-3-[[4-methoxy-3-[(3-oxo-1H-2-benzofuran-1-yl)oxy]pyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 59989544) has the molecular formula C34H34N2O11 and a molecular weight of 646.65 g/mol. Its IUPAC name is [(3S,6S,7R,8R)-8-benzyl-3-[[4-methoxy-3-[(3-oxo-1H-2-benzofuran-1-yl)oxy]pyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(3S,6S,7R,8R)-8-benzyl-3-[[4-methoxy-3-[(3-oxo-1H-2-benzofuran-1-yl)oxy]pyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 59989544 |
| Molecular Formula | C34H34N2O11 |
| Molecular Weight | 646.65 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | [(3S,6S,7R,8R)-8-benzyl-3-[[4-methoxy-3-[(3-oxo-1H-2-benzofuran-1-yl)oxy]pyridine-2-carbonyl]amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC(=O)[C@H](Cc3ccccc3)[C@@H](OC(=O)C(C)C)[C@H](C)OC2=O)c1OC1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C34H34N2O11/c1-18(2)30(38)45-27-19(3)44-33(41)24(17-43-31(39)23(27)16-20-10-6-5-7-11-20)36-29(37)26-28(25(42-4)14-15-35-26)46-34-22-13-9-8-12-21(22)32(40)47-34/h5-15,18-19,23-24,27,34H,16-17H2,1-4H3,(H,36,37)/t19-,23+,24-,27-,34?/m0/s1 |
| InChIKey | UKVJVGGHWHPUJN-SAMLEIMSSA-N |
| XLogP | 3.35 |
| TPSA | 165.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|