C30H36N2O11 — CID 146594582
[(3S,6S,8R)-3-[[3-(1-acetyloxyethoxy)-4-methoxypyridine-2-carbonyl]amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 146594582) has the molecular formula C30H36N2O11 and a molecular weight of 600.62 g/mol. Its IUPAC name is [(3S,6S,8R)-3-[[3-(1-acetyloxyethoxy)-4-methoxypyridine-2-carbonyl]amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(3S,6S,8R)-3-[[3-(1-acetyloxyethoxy)-4-methoxypyridine-2-carbonyl]amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 146594582 |
| Molecular Formula | C30H36N2O11 |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | [(3S,6S,8R)-3-[[3-(1-acetyloxyethoxy)-4-methoxypyridine-2-carbonyl]amino]-8-benzyl-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC(=O)[C@H](Cc3ccccc3)C(OC(=O)C(C)C)[C@H](C)OC2=O)c1OC(C)OC(C)=O |
| InChI | InChI=1S/C30H36N2O11/c1-16(2)28(35)43-25-17(3)40-30(37)22(15-39-29(36)21(25)14-20-10-8-7-9-11-20)32-27(34)24-26(23(38-6)12-13-31-24)42-19(5)41-18(4)33/h7-13,16-17,19,21-22,25H,14-15H2,1-6H3,(H,32,34)/t17-,19?,21+,22-,25?/m0/s1 |
| InChIKey | MMEFVNFDTBIAKK-OFCDWDSKSA-N |
| XLogP | 2.39 |
| TPSA | 165.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|